About (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate
(4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 55943856) has the molecular formula C23H28FNO4
and a molecular weight of 401.48 g/mol. Its IUPAC name is (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
| PubChem CID | 55943856 |
| Molecular Formula | C23H28FNO4 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccc(F)cc1)[C@@H]1CC(O)CN1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H28FNO4/c24-18-3-1-14(2-4-18)13-29-21(27)20-8-19(26)12-25(20)22(28)23-9-15-5-16(10-23)7-17(6-15)11-23/h1-4,15-17,19-20,26H,5-13H2/t15?,16?,17?,19?,20-,23?/m0/s1 |
| InChIKey | AUTJKVLXRBRCNZ-VEDYAPDASA-N |
| XLogP | 3.05 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate?
The IUPAC name of (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate (CID 55943856) is (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate.
What is the SMILES notation for (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate?
The canonical SMILES for (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate is O=C(OCc1ccc(F)cc1)[C@@H]1CC(O)CN1C(=O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate?
The InChIKey is AUTJKVLXRBRCNZ-VEDYAPDASA-N. The full InChI is InChI=1S/C23H28FNO4/c24-18-3-1-14(2-4-18)13-29-21(27)20-8-19(26)12-25(20)22(28)23-9-15-5-16(10-23)7-17(6-15)11-23/h1-4,15-17,19-20,26H,5-13H2/t15?,16?,17?,19?,20-,23?/m0/s1.
What are the key properties of (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate?
(4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate has a molecular weight of 401.48 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl (2S)-1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate is sourced from PubChem (CID 55943856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).