2-formamidobutanoic acid

C5H9NO3 — CID 559455

IUPAC2-formamidobutanoic acid
SMILESCCC(NC=O)C(=O)O
InChIInChI=1S/C5H9NO3/c1-2-4(5(8)9)6-3-7/h3-4H,2H2,1H3,(H,6,7)(H,8,9)
InChIKeyQAISXTKWTBOYAA-UHFFFAOYSA-N
MW131.13 g/mol
LogP-0.40
Rot. Bonds4

About 2-formamidobutanoic acid

2-formamidobutanoic acid (PubChem CID 559455) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is 2-formamidobutanoic acid.

Molecular Properties

Compound Name2-formamidobutanoic acid
PubChem CID559455
Molecular FormulaC5H9NO3
Molecular Weight131.13 g/mol
Exact Mass131.06
IUPAC Name2-formamidobutanoic acid
SMILESCCC(NC=O)C(=O)O
InChIInChI=1S/C5H9NO3/c1-2-4(5(8)9)6-3-7/h3-4H,2H2,1H3,(H,6,7)(H,8,9)
InChIKeyQAISXTKWTBOYAA-UHFFFAOYSA-N
XLogP-0.40
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.13
LogP ≤ 5-0.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-formamidobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-formamidobutanoic acid?
The IUPAC name of 2-formamidobutanoic acid (CID 559455) is 2-formamidobutanoic acid.
What is the SMILES notation for 2-formamidobutanoic acid?
The canonical SMILES for 2-formamidobutanoic acid is CCC(NC=O)C(=O)O.
What is the InChIKey of 2-formamidobutanoic acid?
The InChIKey is QAISXTKWTBOYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-2-4(5(8)9)6-3-7/h3-4H,2H2,1H3,(H,6,7)(H,8,9).
What are the key properties of 2-formamidobutanoic acid?
2-formamidobutanoic acid has a molecular weight of 131.13 g/mol, XLogP of -0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formamidobutanoic acid is sourced from PubChem (CID 559455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).