C22H19ClN2O3S — CID 55948792
N-[2-[2-(4-chlorophenyl)morpholine-4-carbonyl]phenyl]thiophene-2-carboxamide (PubChem CID 55948792) has the molecular formula C22H19ClN2O3S and a molecular weight of 426.93 g/mol. Its IUPAC name is N-[2-[2-(4-chlorophenyl)morpholine-4-carbonyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[2-(4-chlorophenyl)morpholine-4-carbonyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55948792 |
| Molecular Formula | C22H19ClN2O3S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[2-[2-(4-chlorophenyl)morpholine-4-carbonyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)N1CCOC(c2ccc(Cl)cc2)C1)c1cccs1 |
| InChI | InChI=1S/C22H19ClN2O3S/c23-16-9-7-15(8-10-16)19-14-25(11-12-28-19)22(27)17-4-1-2-5-18(17)24-21(26)20-6-3-13-29-20/h1-10,13,19H,11-12,14H2,(H,24,26) |
| InChIKey | FOWGANFOSDZFPV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |