C23H25N3O5S2 — CID 55948834
3-(benzylsulfamoyl)-N-[4-(ethylsulfonylamino)-3-methylphenyl]benzamide (PubChem CID 55948834) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-N-[4-(ethylsulfonylamino)-3-methylphenyl]benzamide.
| Compound Name | 3-(benzylsulfamoyl)-N-[4-(ethylsulfonylamino)-3-methylphenyl]benzamide |
|---|---|
| PubChem CID | 55948834 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 3-(benzylsulfamoyl)-N-[4-(ethylsulfonylamino)-3-methylphenyl]benzamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)c2cccc(S(=O)(=O)NCc3ccccc3)c2)cc1C |
| InChI | InChI=1S/C23H25N3O5S2/c1-3-32(28,29)26-22-13-12-20(14-17(22)2)25-23(27)19-10-7-11-21(15-19)33(30,31)24-16-18-8-5-4-6-9-18/h4-15,24,26H,3,16H2,1-2H3,(H,25,27) |
| InChIKey | KOMUCHVMBAUZGK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |