C20H23N3O3 — CID 55949270
N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide (PubChem CID 55949270) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide.
| Compound Name | N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide |
|---|---|
| PubChem CID | 55949270 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)CCCC2)NCc1nc(C2CC2)no1 |
| InChI | InChI=1S/C20H23N3O3/c24-17(16-8-5-13-3-1-2-4-15(13)11-16)9-10-18(25)21-12-19-22-20(23-26-19)14-6-7-14/h5,8,11,14H,1-4,6-7,9-10,12H2,(H,21,25) |
| InChIKey | OMFYUHRJKGNLEC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |