C21H32N2O3 — CID 55949493
2-(2,5-dimethylphenoxy)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]acetamide (PubChem CID 55949493) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 55949493 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[1-(2-ethylbutanoyl)piperidin-4-yl]acetamide |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)COc2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C21H32N2O3/c1-5-17(6-2)21(25)23-11-9-18(10-12-23)22-20(24)14-26-19-13-15(3)7-8-16(19)4/h7-8,13,17-18H,5-6,9-12,14H2,1-4H3,(H,22,24) |
| InChIKey | LUHRTFYOCVRINQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |