C15H20N4O5S — CID 55949960
1-[2-oxo-2-[4-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 55949960) has the molecular formula C15H20N4O5S and a molecular weight of 368.42 g/mol. Its IUPAC name is 1-[2-oxo-2-[4-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-oxo-2-[4-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55949960 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-[2-oxo-2-[4-[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CN1CSCC1=O)N1CCN(C(=O)CN2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C15H20N4O5S/c20-11-1-2-12(21)19(11)8-14(23)17-5-3-16(4-6-17)13(22)7-18-10-25-9-15(18)24/h1-10H2 |
| InChIKey | QPSKDARWIWOJQU-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|