C20H17N3O3S — CID 55950050
N-[2-(3-ethynylanilino)-2-oxoethyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (PubChem CID 55950050) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[2-(3-ethynylanilino)-2-oxoethyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
| Compound Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 55950050 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)CC2Sc3ccccc3NC2=O)c1 |
| InChI | InChI=1S/C20H17N3O3S/c1-2-13-6-5-7-14(10-13)22-19(25)12-21-18(24)11-17-20(26)23-15-8-3-4-9-16(15)27-17/h1,3-10,17H,11-12H2,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | RUTGMFOQKJNQPY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|