C24H37N3O5S — CID 55950402
N-butyl-N-methyl-1-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]piperidine-4-carboxamide (PubChem CID 55950402) has the molecular formula C24H37N3O5S and a molecular weight of 479.64 g/mol. Its IUPAC name is N-butyl-N-methyl-1-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]piperidine-4-carboxamide.
| Compound Name | N-butyl-N-methyl-1-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55950402 |
| Molecular Formula | C24H37N3O5S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-butyl-N-methyl-1-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]piperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(C(=O)CCc2ccc(S(=O)(=O)N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C24H37N3O5S/c1-3-4-13-25(2)24(29)21-11-14-26(15-12-21)23(28)10-7-20-5-8-22(9-6-20)33(30,31)27-16-18-32-19-17-27/h5-6,8-9,21H,3-4,7,10-19H2,1-2H3 |
| InChIKey | LQTUWCPJNGGUBI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |