C26H24N4O2 — CID 55950490
4-(benzimidazol-1-yl)-N-[3-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 55950490) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-N-[3-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 4-(benzimidazol-1-yl)-N-[3-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55950490 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-(benzimidazol-1-yl)-N-[3-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCCCC2)c1)c1ccc(-n2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C26H24N4O2/c31-25(28-21-8-6-7-20(17-21)26(32)29-15-4-1-5-16-29)19-11-13-22(14-12-19)30-18-27-23-9-2-3-10-24(23)30/h2-3,6-14,17-18H,1,4-5,15-16H2,(H,28,31) |
| InChIKey | YSMWZLRFVZAFLI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |