C19H24N4O5S2 — CID 55951510
1-[4-[methoxy(methyl)sulfamoyl]benzoyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 55951510) has the molecular formula C19H24N4O5S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-[4-[methoxy(methyl)sulfamoyl]benzoyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[4-[methoxy(methyl)sulfamoyl]benzoyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55951510 |
| Molecular Formula | C19H24N4O5S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 1-[4-[methoxy(methyl)sulfamoyl]benzoyl]-N-(4-methyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(C(=O)N2CCC(C(=O)Nc3nc(C)cs3)CC2)cc1 |
| InChI | InChI=1S/C19H24N4O5S2/c1-13-12-29-19(20-13)21-17(24)14-8-10-23(11-9-14)18(25)15-4-6-16(7-5-15)30(26,27)22(2)28-3/h4-7,12,14H,8-11H2,1-3H3,(H,20,21,24) |
| InChIKey | AMKOEDGUAVZTPQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|