C23H28N4O5S — CID 55951793
4-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-morpholin-4-ylphenyl)benzamide (PubChem CID 55951793) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 55951793 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)sulfonyl-N-(3-morpholin-4-ylphenyl)benzamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2ccc(C(=O)Nc3cccc(N4CCOCC4)c3)cc2)CC1 |
| InChI | InChI=1S/C23H28N4O5S/c1-18(28)25-9-11-27(12-10-25)33(30,31)22-7-5-19(6-8-22)23(29)24-20-3-2-4-21(17-20)26-13-15-32-16-14-26/h2-8,17H,9-16H2,1H3,(H,24,29) |
| InChIKey | DHWNBTGKRMQUDG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|