C17H16Br2N2O3 — CID 55955381
5-bromo-N-[2-[2-(4-bromophenyl)pyrrolidin-1-yl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 55955381) has the molecular formula C17H16Br2N2O3 and a molecular weight of 456.13 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-(4-bromophenyl)pyrrolidin-1-yl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[2-(4-bromophenyl)pyrrolidin-1-yl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55955381 |
| Molecular Formula | C17H16Br2N2O3 |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | 5-bromo-N-[2-[2-(4-bromophenyl)pyrrolidin-1-yl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(NCC(=O)N1CCCC1c1ccc(Br)cc1)c1ccc(Br)o1 |
| InChI | InChI=1S/C17H16Br2N2O3/c18-12-5-3-11(4-6-12)13-2-1-9-21(13)16(22)10-20-17(23)14-7-8-15(19)24-14/h3-8,13H,1-2,9-10H2,(H,20,23) |
| InChIKey | JDYVOKOIXFRNIH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |