C27H28N2O3 — CID 55956031
N-[2-[2-[(3-methoxyphenyl)methyl]pyrrolidin-1-yl]-2-oxoethyl]-4-phenylbenzamide (PubChem CID 55956031) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-[2-[2-[(3-methoxyphenyl)methyl]pyrrolidin-1-yl]-2-oxoethyl]-4-phenylbenzamide.
| Compound Name | N-[2-[2-[(3-methoxyphenyl)methyl]pyrrolidin-1-yl]-2-oxoethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 55956031 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[2-[2-[(3-methoxyphenyl)methyl]pyrrolidin-1-yl]-2-oxoethyl]-4-phenylbenzamide |
| SMILES | COc1cccc(CC2CCCN2C(=O)CNC(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H28N2O3/c1-32-25-11-5-7-20(18-25)17-24-10-6-16-29(24)26(30)19-28-27(31)23-14-12-22(13-15-23)21-8-3-2-4-9-21/h2-5,7-9,11-15,18,24H,6,10,16-17,19H2,1H3,(H,28,31) |
| InChIKey | QJLWISSCTKNOHZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |