C27H31N3O4S — CID 55956313
3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-4-methyl-N-(2-methylphenyl)benzenesulfonamide (PubChem CID 55956313) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-4-methyl-N-(2-methylphenyl)benzenesulfonamide.
| Compound Name | 3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-4-methyl-N-(2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55956313 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-4-methyl-N-(2-methylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(N2CCCN(C(=O)c3cc(S(=O)(=O)Nc4ccccc4C)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C27H31N3O4S/c1-20-9-14-24(35(32,33)28-26-8-5-4-7-21(26)2)19-25(20)27(31)30-16-6-15-29(17-18-30)22-10-12-23(34-3)13-11-22/h4-5,7-14,19,28H,6,15-18H2,1-3H3 |
| InChIKey | OUXKOPXABNXMDD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|