C22H30N2O4S — CID 55957065
3-[(3,4-dimethylphenyl)sulfonylamino]-N-methyl-N-[3-(2-methylphenoxy)propyl]propanamide (PubChem CID 55957065) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfonylamino]-N-methyl-N-[3-(2-methylphenoxy)propyl]propanamide.
| Compound Name | 3-[(3,4-dimethylphenyl)sulfonylamino]-N-methyl-N-[3-(2-methylphenoxy)propyl]propanamide |
|---|---|
| PubChem CID | 55957065 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)sulfonylamino]-N-methyl-N-[3-(2-methylphenoxy)propyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)N(C)CCCOc2ccccc2C)cc1C |
| InChI | InChI=1S/C22H30N2O4S/c1-17-10-11-20(16-19(17)3)29(26,27)23-13-12-22(25)24(4)14-7-15-28-21-9-6-5-8-18(21)2/h5-6,8-11,16,23H,7,12-15H2,1-4H3 |
| InChIKey | URISXPJSXUSCTK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|