C22H21ClN2O4 — CID 55957420
2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylacetamide (PubChem CID 55957420) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylacetamide.
| Compound Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 55957420 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylacetamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)Cc2cc(Cl)c3c(c2)OCCCO3)c1 |
| InChI | InChI=1S/C22H21ClN2O4/c1-3-15-6-4-7-17(10-15)24-20(26)14-25(2)21(27)13-16-11-18(23)22-19(12-16)28-8-5-9-29-22/h1,4,6-7,10-12H,5,8-9,13-14H2,2H3,(H,24,26) |
| InChIKey | FRBNQUFHZBMOQN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|