C26H29N3O3 — CID 55957431
1-(3,5-dimethylbenzoyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpiperidine-3-carboxamide (PubChem CID 55957431) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzoyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-(3,5-dimethylbenzoyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55957431 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-(3,5-dimethylbenzoyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpiperidine-3-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)C2CCCN(C(=O)c3cc(C)cc(C)c3)C2)c1 |
| InChI | InChI=1S/C26H29N3O3/c1-5-20-8-6-10-23(15-20)27-24(30)17-28(4)25(31)21-9-7-11-29(16-21)26(32)22-13-18(2)12-19(3)14-22/h1,6,8,10,12-15,21H,7,9,11,16-17H2,2-4H3,(H,27,30) |
| InChIKey | XMQXIZOTVIRYBR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|