About 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane
6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane (PubChem CID 559604) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 559604 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane |
| SMILES | CC1OC1C1CCC(C)(C)C2(C1)OCCO2 |
| InChI | InChI=1S/C13H22O3/c1-9-11(16-9)10-4-5-12(2,3)13(8-10)14-6-7-15-13/h9-11H,4-8H2,1-3H3 |
| InChIKey | QMYMTJPYPOWMQM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane (CID 559604) is 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane is CC1OC1C1CCC(C)(C)C2(C1)OCCO2.
What is the InChIKey of 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane?
The InChIKey is QMYMTJPYPOWMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-9-11(16-9)10-4-5-12(2,3)13(8-10)14-6-7-15-13/h9-11H,4-8H2,1-3H3.
What are the key properties of 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane?
6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane has a molecular weight of 226.32 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-9-(3-methyloxiran-2-yl)-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 559604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).