C26H30N4O4S — CID 55960540
N-methyl-1,1,3-trioxo-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-2-propan-2-yl-1,2-benzothiazole-6-carboxamide (PubChem CID 55960540) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is N-methyl-1,1,3-trioxo-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-2-propan-2-yl-1,2-benzothiazole-6-carboxamide.
| Compound Name | N-methyl-1,1,3-trioxo-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-2-propan-2-yl-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 55960540 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-methyl-1,1,3-trioxo-N-[5-(3-phenyl-1H-pyrazol-5-yl)pentyl]-2-propan-2-yl-1,2-benzothiazole-6-carboxamide |
| SMILES | CC(C)N1C(=O)c2ccc(C(=O)N(C)CCCCCc3cc(-c4ccccc4)n[nH]3)cc2S1(=O)=O |
| InChI | InChI=1S/C26H30N4O4S/c1-18(2)30-26(32)22-14-13-20(16-24(22)35(30,33)34)25(31)29(3)15-9-5-8-12-21-17-23(28-27-21)19-10-6-4-7-11-19/h4,6-7,10-11,13-14,16-18H,5,8-9,12,15H2,1-3H3,(H,27,28) |
| InChIKey | OBYFIPJVBFDTDM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|