C22H24N4O6S — CID 55962762
2-methyl-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55962762) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is 2-methyl-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-methyl-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55962762 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-methyl-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)Nc1cccc(C2(C)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C22H24N4O6S/c1-14-6-7-17(33(30,31)26-8-10-32-11-9-26)13-18(14)19(27)23-16-5-3-4-15(12-16)22(2)20(28)24-21(29)25-22/h3-7,12-13H,8-11H2,1-2H3,(H,23,27)(H2,24,25,28,29) |
| InChIKey | GETSZELFBFQGSY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|