C24H31N3O5S — CID 55962836
2-methyl-N-[1-[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]piperidin-4-yl]benzamide (PubChem CID 55962836) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-methyl-N-[1-[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]piperidin-4-yl]benzamide.
| Compound Name | 2-methyl-N-[1-[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 55962836 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 2-methyl-N-[1-[2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetyl]piperidin-4-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC1CCN(C(=O)CS(=O)(=O)Nc2ccc(OC(C)C)cc2)CC1 |
| InChI | InChI=1S/C24H31N3O5S/c1-17(2)32-21-10-8-20(9-11-21)26-33(30,31)16-23(28)27-14-12-19(13-15-27)25-24(29)22-7-5-4-6-18(22)3/h4-11,17,19,26H,12-16H2,1-3H3,(H,25,29) |
| InChIKey | ANJHHAAQWNTXKN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |