C18H21FN4O4S — CID 55963206
N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide (PubChem CID 55963206) has the molecular formula C18H21FN4O4S and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 55963206 |
| Molecular Formula | C18H21FN4O4S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[1-[4-(carbamoylamino)phenyl]ethyl]-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide |
| SMILES | CC(NC(=O)CN(C)S(=O)(=O)c1ccc(F)cc1)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C18H21FN4O4S/c1-12(13-3-7-15(8-4-13)22-18(20)25)21-17(24)11-23(2)28(26,27)16-9-5-14(19)6-10-16/h3-10,12H,11H2,1-2H3,(H,21,24)(H3,20,22,25) |
| InChIKey | YRIKIPARFIOEFZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |