C19H27N3O4 — CID 55965160
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)acetamide (PubChem CID 55965160) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)acetamide |
|---|---|
| PubChem CID | 55965160 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)acetamide |
| SMILES | CCN1CCN(CC(=O)NC2CC(C)(C)Cc3oc(C)cc32)C(=O)C1=O |
| InChI | InChI=1S/C19H27N3O4/c1-5-21-6-7-22(18(25)17(21)24)11-16(23)20-14-9-19(3,4)10-15-13(14)8-12(2)26-15/h8,14H,5-7,9-11H2,1-4H3,(H,20,23) |
| InChIKey | WSEUGJONIRUQEZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|