C12H18O8S — CID 559654
1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-3,14,17-trione (PubChem CID 559654) has the molecular formula C12H18O8S and a molecular weight of 322.34 g/mol. Its IUPAC name is 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-3,14,17-trione.
| Compound Name | 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-3,14,17-trione |
|---|---|
| PubChem CID | 559654 |
| Molecular Formula | C12H18O8S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1,4,7,10,13-pentaoxa-16-thiacyclooctadecane-3,14,17-trione |
| SMILES | O=C1COCC(=O)SCC(=O)OCCOCCOCCO1 |
| InChI | InChI=1S/C12H18O8S/c13-10-7-18-8-12(15)21-9-11(14)20-6-4-17-2-1-16-3-5-19-10/h1-9H2 |
| InChIKey | NQVYWSHBYVOBJU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|