C25H28N4O3 — CID 55970974
1-[5-(4-naphthalen-1-yloxybutanoylamino)-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 55970974) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-[5-(4-naphthalen-1-yloxybutanoylamino)-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[5-(4-naphthalen-1-yloxybutanoylamino)-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55970974 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 1-[5-(4-naphthalen-1-yloxybutanoylamino)-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2ccc(NC(=O)CCCOc3cccc4ccccc34)cn2)C1 |
| InChI | InChI=1S/C25H28N4O3/c26-25(31)19-8-4-14-29(17-19)23-13-12-20(16-27-23)28-24(30)11-5-15-32-22-10-3-7-18-6-1-2-9-21(18)22/h1-3,6-7,9-10,12-13,16,19H,4-5,8,11,14-15,17H2,(H2,26,31)(H,28,30) |
| InChIKey | GFDLZQMQIULBMS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|