C21H30N4O3 — CID 55972021
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[4-[(2-methylpiperidin-1-yl)methyl]phenyl]acetamide (PubChem CID 55972021) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[4-[(2-methylpiperidin-1-yl)methyl]phenyl]acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[4-[(2-methylpiperidin-1-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55972021 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[4-[(2-methylpiperidin-1-yl)methyl]phenyl]acetamide |
| SMILES | CCN1CCN(CC(=O)Nc2ccc(CN3CCCCC3C)cc2)C(=O)C1=O |
| InChI | InChI=1S/C21H30N4O3/c1-3-23-12-13-25(21(28)20(23)27)15-19(26)22-18-9-7-17(8-10-18)14-24-11-5-4-6-16(24)2/h7-10,16H,3-6,11-15H2,1-2H3,(H,22,26) |
| InChIKey | CSQXOXPZWGIESB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|