C25H26N4O4S — CID 55972452
N-[2-[[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 55972452) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is N-[2-[[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 55972452 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[2-[[3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)Nc3ccccc3NC(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C25H26N4O4S/c1-18-11-13-20(14-12-18)28-34(32,33)21-8-6-7-19(17-21)24(30)26-22-9-2-3-10-23(22)27-25(31)29-15-4-5-16-29/h2-3,6-14,17,28H,4-5,15-16H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | SDELBGUWAPKEFY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |