C25H28N4O4 — CID 55974424
N-(4-butoxy-2-methylphenyl)-1-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperidine-4-carboxamide (PubChem CID 55974424) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-(4-butoxy-2-methylphenyl)-1-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperidine-4-carboxamide.
| Compound Name | N-(4-butoxy-2-methylphenyl)-1-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55974424 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-(4-butoxy-2-methylphenyl)-1-[4-cyano-2-(furan-2-yl)-1,3-oxazol-5-yl]piperidine-4-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)C2CCN(c3oc(-c4ccco4)nc3C#N)CC2)c(C)c1 |
| InChI | InChI=1S/C25H28N4O4/c1-3-4-13-31-19-7-8-20(17(2)15-19)27-23(30)18-9-11-29(12-10-18)25-21(16-26)28-24(33-25)22-6-5-14-32-22/h5-8,14-15,18H,3-4,9-13H2,1-2H3,(H,27,30) |
| InChIKey | IYLMAZLOGJRNJU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|