C22H25BrN2O2 — CID 55975233
N-[3-[[1-(3-bromophenyl)cyclobutyl]methylamino]-3-oxopropyl]-2-methylbenzamide (PubChem CID 55975233) has the molecular formula C22H25BrN2O2 and a molecular weight of 429.36 g/mol. Its IUPAC name is N-[3-[[1-(3-bromophenyl)cyclobutyl]methylamino]-3-oxopropyl]-2-methylbenzamide.
| Compound Name | N-[3-[[1-(3-bromophenyl)cyclobutyl]methylamino]-3-oxopropyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55975233 |
| Molecular Formula | C22H25BrN2O2 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[3-[[1-(3-bromophenyl)cyclobutyl]methylamino]-3-oxopropyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NCCC(=O)NCC1(c2cccc(Br)c2)CCC1 |
| InChI | InChI=1S/C22H25BrN2O2/c1-16-6-2-3-9-19(16)21(27)24-13-10-20(26)25-15-22(11-5-12-22)17-7-4-8-18(23)14-17/h2-4,6-9,14H,5,10-13,15H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | ONJBAFGMRMJDCU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |