C22H26FN3OS — CID 55976186
N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-thiophen-3-ylpropanamide (PubChem CID 55976186) has the molecular formula C22H26FN3OS and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-thiophen-3-ylpropanamide.
| Compound Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 55976186 |
| Molecular Formula | C22H26FN3OS |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-[5-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]pentyl]-N-methyl-3-thiophen-3-ylpropanamide |
| SMILES | CN(CCCCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)CCc1ccsc1 |
| InChI | InChI=1S/C22H26FN3OS/c1-26(22(27)10-9-17-11-13-28-16-17)12-4-2-3-8-20-15-21(25-24-20)18-6-5-7-19(23)14-18/h5-7,11,13-16H,2-4,8-10,12H2,1H3,(H,24,25) |
| InChIKey | SOJBEBAGIGPOEC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|