C23H27FN4O2 — CID 55979952
N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 55979952) has the molecular formula C23H27FN4O2 and a molecular weight of 410.49 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55979952 |
| Molecular Formula | C23H27FN4O2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-1-[(4-fluorophenyl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | CCN(Cc1ccc(N(C)C)cc1)C(=O)C1=NN(Cc2ccc(F)cc2)C(=O)CC1 |
| InChI | InChI=1S/C23H27FN4O2/c1-4-27(15-17-7-11-20(12-8-17)26(2)3)23(30)21-13-14-22(29)28(25-21)16-18-5-9-19(24)10-6-18/h5-12H,4,13-16H2,1-3H3 |
| InChIKey | WIBVKMWFBSHBGY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|