C17H18BrFN2O3 — CID 55981552
2-(4-bromo-2-fluorophenoxy)-N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 55981552) has the molecular formula C17H18BrFN2O3 and a molecular weight of 397.24 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenoxy)-N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-(4-bromo-2-fluorophenoxy)-N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 55981552 |
| Molecular Formula | C17H18BrFN2O3 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-(4-bromo-2-fluorophenoxy)-N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | COCCN(Cc1ccccn1)C(=O)COc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H18BrFN2O3/c1-23-9-8-21(11-14-4-2-3-7-20-14)17(22)12-24-16-6-5-13(18)10-15(16)19/h2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | RSMYZEYDCYYKGC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |