About 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol
2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 559819) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol |
| PubChem CID | 559819 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCCCCCCCCOC1C=CC(O)C(CO)O1 |
| InChI | InChI=1S/C15H28O4/c1-2-3-4-5-6-7-8-11-18-15-10-9-13(17)14(12-16)19-15/h9-10,13-17H,2-8,11-12H2,1H3 |
| InChIKey | XCKRNVUDGPRNLB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol?
The IUPAC name of 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol (CID 559819) is 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol.
What is the SMILES notation for 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol?
The canonical SMILES for 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol is CCCCCCCCCOC1C=CC(O)C(CO)O1.
What is the InChIKey of 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol?
The InChIKey is XCKRNVUDGPRNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O4/c1-2-3-4-5-6-7-8-11-18-15-10-9-13(17)14(12-16)19-15/h9-10,13-17H,2-8,11-12H2,1H3.
What are the key properties of 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol?
2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol has a molecular weight of 272.38 g/mol, XLogP of 2.39, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-6-nonoxy-3,6-dihydro-2H-pyran-3-ol is sourced from PubChem (CID 559819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).