C24H29N3O2 — CID 55982371
3-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]-N-phenylpiperidine-1-carboxamide (PubChem CID 55982371) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 3-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 3-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 55982371 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 3-[2-(2-methylphenyl)pyrrolidine-1-carbonyl]-N-phenylpiperidine-1-carboxamide |
| SMILES | Cc1ccccc1C1CCCN1C(=O)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C24H29N3O2/c1-18-9-5-6-13-21(18)22-14-8-16-27(22)23(28)19-10-7-15-26(17-19)24(29)25-20-11-3-2-4-12-20/h2-6,9,11-13,19,22H,7-8,10,14-17H2,1H3,(H,25,29) |
| InChIKey | ZPXMPWVCEZQFFY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |