C23H32BrN3O4 — CID 55984345
2-methoxyethyl 5-[(3-bromophenyl)-[2-(diethylamino)ethyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 55984345) has the molecular formula C23H32BrN3O4 and a molecular weight of 494.43 g/mol. Its IUPAC name is 2-methoxyethyl 5-[(3-bromophenyl)-[2-(diethylamino)ethyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | 2-methoxyethyl 5-[(3-bromophenyl)-[2-(diethylamino)ethyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55984345 |
| Molecular Formula | C23H32BrN3O4 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-methoxyethyl 5-[(3-bromophenyl)-[2-(diethylamino)ethyl]carbamoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCN(CC)CCN(C(=O)c1[nH]c(C)c(C(=O)OCCOC)c1C)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H32BrN3O4/c1-6-26(7-2)11-12-27(19-10-8-9-18(24)15-19)22(28)21-16(3)20(17(4)25-21)23(29)31-14-13-30-5/h8-10,15,25H,6-7,11-14H2,1-5H3 |
| InChIKey | DYCCNMJXROWGHJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|