methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate

C16H22N2O4 — CID 55987244

IUPACmethyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)CN2CCOCC2(C)C)cc1
InChIInChI=1S/C16H22N2O4/c1-16(2)11-22-9-8-18(16)10-14(19)17-13-6-4-12(5-7-13)15(20)21-3/h4-7H,8-11H2,1-3H3,(H,17,19)
InChIKeyHWKSEVMCMXZBEE-UHFFFAOYSA-N
MW306.36 g/mol
LogP1.52
Rot. Bonds4

About methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate

methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate (PubChem CID 55987244) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate.

Molecular Properties

Compound Namemethyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate
PubChem CID55987244
Molecular FormulaC16H22N2O4
Molecular Weight306.36 g/mol
Exact Mass306.16
IUPAC Namemethyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)CN2CCOCC2(C)C)cc1
InChIInChI=1S/C16H22N2O4/c1-16(2)11-22-9-8-18(16)10-14(19)17-13-6-4-12(5-7-13)15(20)21-3/h4-7H,8-11H2,1-3H3,(H,17,19)
InChIKeyHWKSEVMCMXZBEE-UHFFFAOYSA-N
XLogP1.52
TPSA67.87 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.36
LogP ≤ 51.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate?
The IUPAC name of methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate (CID 55987244) is methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate.
What is the SMILES notation for methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate?
The canonical SMILES for methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate is COC(=O)c1ccc(NC(=O)CN2CCOCC2(C)C)cc1.
What is the InChIKey of methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate?
The InChIKey is HWKSEVMCMXZBEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O4/c1-16(2)11-22-9-8-18(16)10-14(19)17-13-6-4-12(5-7-13)15(20)21-3/h4-7H,8-11H2,1-3H3,(H,17,19).
What are the key properties of methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate?
methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate has a molecular weight of 306.36 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(3,3-dimethylmorpholin-4-yl)acetyl]amino]benzoate is sourced from PubChem (CID 55987244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).