C23H36N4O4S — CID 55987288
N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[4-(prop-2-enylsulfamoyl)benzoyl]piperidine-4-carboxamide (PubChem CID 55987288) has the molecular formula C23H36N4O4S and a molecular weight of 464.63 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[4-(prop-2-enylsulfamoyl)benzoyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[4-(prop-2-enylsulfamoyl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55987288 |
| Molecular Formula | C23H36N4O4S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-[4-(prop-2-enylsulfamoyl)benzoyl]piperidine-4-carboxamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)N2CCC(C(=O)NCC(C)(C)CN(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H36N4O4S/c1-6-13-25-32(30,31)20-9-7-19(8-10-20)22(29)27-14-11-18(12-15-27)21(28)24-16-23(2,3)17-26(4)5/h6-10,18,25H,1,11-17H2,2-5H3,(H,24,28) |
| InChIKey | KHVGFYCIJLUIKN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|