C22H44N2O2S — CID 559874
N,N-dibutyl-3-[3-(dibutylamino)-3-oxopropyl]sulfanylpropanamide (PubChem CID 559874) has the molecular formula C22H44N2O2S and a molecular weight of 400.67 g/mol. Its IUPAC name is N,N-dibutyl-3-[3-(dibutylamino)-3-oxopropyl]sulfanylpropanamide.
| Compound Name | N,N-dibutyl-3-[3-(dibutylamino)-3-oxopropyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 559874 |
| Molecular Formula | C22H44N2O2S |
| Molecular Weight | 400.67 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | N,N-dibutyl-3-[3-(dibutylamino)-3-oxopropyl]sulfanylpropanamide |
| SMILES | CCCCN(CCCC)C(=O)CCSCCC(=O)N(CCCC)CCCC |
| InChI | InChI=1S/C22H44N2O2S/c1-5-9-15-23(16-10-6-2)21(25)13-19-27-20-14-22(26)24(17-11-7-3)18-12-8-4/h5-20H2,1-4H3 |
| InChIKey | BPRVAKQVDPDWMQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|