C21H34N4O5S — CID 55987518
N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 55987518) has the molecular formula C21H34N4O5S and a molecular weight of 454.59 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55987518 |
| Molecular Formula | C21H34N4O5S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-(2,3-dimethyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCC(C(=O)NCC(C)(C)CN(C)C)CC2)c1C |
| InChI | InChI=1S/C21H34N4O5S/c1-15-11-18(25(27)28)12-19(16(15)2)31(29,30)24-9-7-17(8-10-24)20(26)22-13-21(3,4)14-23(5)6/h11-12,17H,7-10,13-14H2,1-6H3,(H,22,26) |
| InChIKey | LQKKNJMNNGIUON-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|