C18H16N6O3S2 — CID 55988523
3-methyl-2-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methylsulfanyl]quinazolin-4-one (PubChem CID 55988523) has the molecular formula C18H16N6O3S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 3-methyl-2-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-methyl-2-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 55988523 |
| Molecular Formula | C18H16N6O3S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 3-methyl-2-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methylsulfanyl]quinazolin-4-one |
| SMILES | Cn1c(SCc2nnnn2-c2ccc(S(C)(=O)=O)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H16N6O3S2/c1-23-17(25)14-5-3-4-6-15(14)19-18(23)28-11-16-20-21-22-24(16)12-7-9-13(10-8-12)29(2,26)27/h3-10H,11H2,1-2H3 |
| InChIKey | XHGYSOOBROAQDL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 112.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |