C24H34N4O4 — CID 55990684
4-[[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-propan-2-ylbenzamide (PubChem CID 55990684) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 4-[[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 55990684 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 4-[[2-(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(NC(=O)CN2C(=O)NC3(CCC(C(C)(C)C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H34N4O4/c1-15(2)25-20(30)16-6-8-18(9-7-16)26-19(29)14-28-21(31)24(27-22(28)32)12-10-17(11-13-24)23(3,4)5/h6-9,15,17H,10-14H2,1-5H3,(H,25,30)(H,26,29)(H,27,32) |
| InChIKey | IQPADDOQBDBHEA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|