C25H29N3O4S — CID 55993376
N-[5-(3,5-dimethylpiperidine-1-carbonyl)-2-methylphenyl]-3-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 55993376) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-[5-(3,5-dimethylpiperidine-1-carbonyl)-2-methylphenyl]-3-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-[5-(3,5-dimethylpiperidine-1-carbonyl)-2-methylphenyl]-3-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55993376 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[5-(3,5-dimethylpiperidine-1-carbonyl)-2-methylphenyl]-3-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)Nc2cc(C(=O)N3CC(C)CC(C)C3)ccc2C)c1 |
| InChI | InChI=1S/C25H29N3O4S/c1-5-11-26-33(31,32)22-8-6-7-20(13-22)24(29)27-23-14-21(10-9-19(23)4)25(30)28-15-17(2)12-18(3)16-28/h1,6-10,13-14,17-18,26H,11-12,15-16H2,2-4H3,(H,27,29) |
| InChIKey | UYWMZAPZBMCXGE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|