C21H24ClN3O5S — CID 55993465
N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-5-(cyclopropylsulfamoyl)-2-methylbenzamide (PubChem CID 55993465) has the molecular formula C21H24ClN3O5S and a molecular weight of 465.96 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-5-(cyclopropylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-5-(cyclopropylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 55993465 |
| Molecular Formula | C21H24ClN3O5S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[3-chloro-4-(2-methoxyethylcarbamoyl)phenyl]-5-(cyclopropylsulfamoyl)-2-methylbenzamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)c2cc(S(=O)(=O)NC3CC3)ccc2C)cc1Cl |
| InChI | InChI=1S/C21H24ClN3O5S/c1-13-3-7-16(31(28,29)25-14-4-5-14)12-18(13)21(27)24-15-6-8-17(19(22)11-15)20(26)23-9-10-30-2/h3,6-8,11-12,14,25H,4-5,9-10H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | HYULWQWFEDSHKA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|