C19H15ClN4O — CID 55993679
N-(5-chloro-2-pyrazol-1-ylphenyl)-6-methyl-1H-indole-2-carboxamide (PubChem CID 55993679) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is N-(5-chloro-2-pyrazol-1-ylphenyl)-6-methyl-1H-indole-2-carboxamide.
| Compound Name | N-(5-chloro-2-pyrazol-1-ylphenyl)-6-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55993679 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(5-chloro-2-pyrazol-1-ylphenyl)-6-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)Nc3cc(Cl)ccc3-n3cccn3)[nH]c2c1 |
| InChI | InChI=1S/C19H15ClN4O/c1-12-3-4-13-10-17(22-15(13)9-12)19(25)23-16-11-14(20)5-6-18(16)24-8-2-7-21-24/h2-11,22H,1H3,(H,23,25) |
| InChIKey | JGSJSHPSGVIXOP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |