C20H28F3N3O2S2 — CID 55996235
3-[3-(dimethylamino)propyl]-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 55996235) has the molecular formula C20H28F3N3O2S2 and a molecular weight of 463.59 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[3-(dimethylamino)propyl]-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55996235 |
| Molecular Formula | C20H28F3N3O2S2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-2-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CN(C)CCCn1c(SCCCOCC(F)(F)F)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C20H28F3N3O2S2/c1-25(2)9-5-10-26-18(27)16-14-7-3-4-8-15(14)30-17(16)24-19(26)29-12-6-11-28-13-20(21,22)23/h3-13H2,1-2H3 |
| InChIKey | GAGLDNGDFAXJOX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|