C21H23ClFNO2S — CID 55996291
4-(3-chlorophenyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]oxane-4-carboxamide (PubChem CID 55996291) has the molecular formula C21H23ClFNO2S and a molecular weight of 407.94 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]oxane-4-carboxamide.
| Compound Name | 4-(3-chlorophenyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 55996291 |
| Molecular Formula | C21H23ClFNO2S |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-(3-chlorophenyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]oxane-4-carboxamide |
| SMILES | O=C(NCCCSc1ccc(F)cc1)C1(c2cccc(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C21H23ClFNO2S/c22-17-4-1-3-16(15-17)21(9-12-26-13-10-21)20(25)24-11-2-14-27-19-7-5-18(23)6-8-19/h1,3-8,15H,2,9-14H2,(H,24,25) |
| InChIKey | KOQQRVZOOGMAKG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|