C19H18FN7OS — CID 55996769
N-[3-cyano-1-(3-fluorophenyl)-4,5-dimethylpyrrol-2-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide (PubChem CID 55996769) has the molecular formula C19H18FN7OS and a molecular weight of 411.47 g/mol. Its IUPAC name is N-[3-cyano-1-(3-fluorophenyl)-4,5-dimethylpyrrol-2-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[3-cyano-1-(3-fluorophenyl)-4,5-dimethylpyrrol-2-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 55996769 |
| Molecular Formula | C19H18FN7OS |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[3-cyano-1-(3-fluorophenyl)-4,5-dimethylpyrrol-2-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C=CCn1nnnc1SCC(=O)Nc1c(C#N)c(C)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H18FN7OS/c1-4-8-26-19(23-24-25-26)29-11-17(28)22-18-16(10-21)12(2)13(3)27(18)15-7-5-6-14(20)9-15/h4-7,9H,1,8,11H2,2-3H3,(H,22,28) |
| InChIKey | YDWGZCCBOVPRDB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|