About [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone
[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone (PubChem CID 55996924) has the molecular formula C19H21F2N3O5S
and a molecular weight of 441.46 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone.
Molecular Properties
| Compound Name | [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone |
| PubChem CID | 55996924 |
| Molecular Formula | C19H21F2N3O5S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone |
| SMILES | COCCOc1ncccc1C(=O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H21F2N3O5S/c1-28-11-12-29-18-15(3-2-6-22-18)19(25)23-7-9-24(10-8-23)30(26,27)14-4-5-16(20)17(21)13-14/h2-6,13H,7-12H2,1H3 |
| InChIKey | OAYADNJPQNXCJP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone?
The IUPAC name of [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone (CID 55996924) is [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone.
What is the SMILES notation for [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone?
The canonical SMILES for [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone is COCCOc1ncccc1C(=O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1.
What is the InChIKey of [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone?
The InChIKey is OAYADNJPQNXCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2N3O5S/c1-28-11-12-29-18-15(3-2-6-22-18)19(25)23-7-9-24(10-8-23)30(26,27)14-4-5-16(20)17(21)13-14/h2-6,13H,7-12H2,1H3.
What are the key properties of [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone?
[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone has a molecular weight of 441.46 g/mol, XLogP of 1.53, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-[2-(2-methoxyethoxy)-3-pyridinyl]methanone is sourced from PubChem (CID 55996924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).