C16H16N6OS2 — CID 55997540
N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide (PubChem CID 55997540) has the molecular formula C16H16N6OS2 and a molecular weight of 372.48 g/mol. Its IUPAC name is N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 55997540 |
| Molecular Formula | C16H16N6OS2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C=CCn1nnnc1SCC(=O)Nc1nc(-c2ccc(C)cc2)cs1 |
| InChI | InChI=1S/C16H16N6OS2/c1-3-8-22-16(19-20-21-22)25-10-14(23)18-15-17-13(9-24-15)12-6-4-11(2)5-7-12/h3-7,9H,1,8,10H2,2H3,(H,17,18,23) |
| InChIKey | GYLPQKBBDICENI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|